C21H25NO2 — CID 95560288
(4R)-4-(2-hydroxyethyl)-3,3-diphenyl-1-propan-2-ylpyrrolidin-2-one (PubChem CID 95560288) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is (4R)-4-(2-hydroxyethyl)-3,3-diphenyl-1-propan-2-ylpyrrolidin-2-one.
| Compound Name | (4R)-4-(2-hydroxyethyl)-3,3-diphenyl-1-propan-2-ylpyrrolidin-2-one |
|---|---|
| PubChem CID | 95560288 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | (4R)-4-(2-hydroxyethyl)-3,3-diphenyl-1-propan-2-ylpyrrolidin-2-one |
| SMILES | CC(C)N1C[C@H](CCO)C(c2ccccc2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C21H25NO2/c1-16(2)22-15-19(13-14-23)21(20(22)24,17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,16,19,23H,13-15H2,1-2H3/t19-/m0/s1 |
| InChIKey | USTQCZYHQIGDCY-IBGZPJMESA-N |
| XLogP | 3.22 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |