About 1-methyl-3-[(1S)-2,2,2-tribromo-1-hydroxyethyl]urea
1-methyl-3-[(1S)-2,2,2-tribromo-1-hydroxyethyl]urea (PubChem CID 95560533) has the molecular formula C4H7Br3N2O2
and a molecular weight of 354.82 g/mol. Its IUPAC name is 1-methyl-3-[(1S)-2,2,2-tribromo-1-hydroxyethyl]urea.
Molecular Properties
| Compound Name | 1-methyl-3-[(1S)-2,2,2-tribromo-1-hydroxyethyl]urea |
| PubChem CID | 95560533 |
| Molecular Formula | C4H7Br3N2O2 |
| Molecular Weight | 354.82 g/mol |
| Exact Mass | 351.81 |
| IUPAC Name | 1-methyl-3-[(1S)-2,2,2-tribromo-1-hydroxyethyl]urea |
| SMILES | CNC(=O)N[C@@H](O)C(Br)(Br)Br |
| InChI | InChI=1S/C4H7Br3N2O2/c1-8-3(11)9-2(10)4(5,6)7/h2,10H,1H3,(H2,8,9,11)/t2-/m0/s1 |
| InChIKey | WCJMXQUWBWUWKX-REOHCLBHSA-N |
| XLogP | 1.07 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.82 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-[(1S)-2,2,2-tribromo-1-hydroxyethyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-[(1S)-2,2,2-tribromo-1-hydroxyethyl]urea?
The IUPAC name of 1-methyl-3-[(1S)-2,2,2-tribromo-1-hydroxyethyl]urea (CID 95560533) is 1-methyl-3-[(1S)-2,2,2-tribromo-1-hydroxyethyl]urea.
What is the SMILES notation for 1-methyl-3-[(1S)-2,2,2-tribromo-1-hydroxyethyl]urea?
The canonical SMILES for 1-methyl-3-[(1S)-2,2,2-tribromo-1-hydroxyethyl]urea is CNC(=O)N[C@@H](O)C(Br)(Br)Br.
What is the InChIKey of 1-methyl-3-[(1S)-2,2,2-tribromo-1-hydroxyethyl]urea?
The InChIKey is WCJMXQUWBWUWKX-REOHCLBHSA-N. The full InChI is InChI=1S/C4H7Br3N2O2/c1-8-3(11)9-2(10)4(5,6)7/h2,10H,1H3,(H2,8,9,11)/t2-/m0/s1.
What are the key properties of 1-methyl-3-[(1S)-2,2,2-tribromo-1-hydroxyethyl]urea?
1-methyl-3-[(1S)-2,2,2-tribromo-1-hydroxyethyl]urea has a molecular weight of 354.82 g/mol, XLogP of 1.07, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-[(1S)-2,2,2-tribromo-1-hydroxyethyl]urea is sourced from PubChem (CID 95560533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).