C18H24N2O — CID 95561109
N-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]ethyl]naphthalen-1-amine (PubChem CID 95561109) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is N-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]ethyl]naphthalen-1-amine.
| Compound Name | N-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]ethyl]naphthalen-1-amine |
|---|---|
| PubChem CID | 95561109 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | N-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]ethyl]naphthalen-1-amine |
| SMILES | C[C@H]1CN(CCNc2cccc3ccccc23)C[C@H](C)O1 |
| InChI | InChI=1S/C18H24N2O/c1-14-12-20(13-15(2)21-14)11-10-19-18-9-5-7-16-6-3-4-8-17(16)18/h3-9,14-15,19H,10-13H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | SNMLJOYSKAGWBK-GJZGRUSLSA-N |
| XLogP | 3.36 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |