C19H24N4O3S — CID 95561268
(3R)-N,N,4-trimethyl-3-[2-oxo-2-[2-(1,3-thiazol-4-yl)ethylamino]ethyl]-2,3-dihydro-1,4-benzoxazine-6-carboxamide (PubChem CID 95561268) has the molecular formula C19H24N4O3S and a molecular weight of 388.49 g/mol. Its IUPAC name is (3R)-N,N,4-trimethyl-3-[2-oxo-2-[2-(1,3-thiazol-4-yl)ethylamino]ethyl]-2,3-dihydro-1,4-benzoxazine-6-carboxamide.
| Compound Name | (3R)-N,N,4-trimethyl-3-[2-oxo-2-[2-(1,3-thiazol-4-yl)ethylamino]ethyl]-2,3-dihydro-1,4-benzoxazine-6-carboxamide |
|---|---|
| PubChem CID | 95561268 |
| Molecular Formula | C19H24N4O3S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | (3R)-N,N,4-trimethyl-3-[2-oxo-2-[2-(1,3-thiazol-4-yl)ethylamino]ethyl]-2,3-dihydro-1,4-benzoxazine-6-carboxamide |
| SMILES | CN(C)C(=O)c1ccc2c(c1)N(C)[C@H](CC(=O)NCCc1cscn1)CO2 |
| InChI | InChI=1S/C19H24N4O3S/c1-22(2)19(25)13-4-5-17-16(8-13)23(3)15(10-26-17)9-18(24)20-7-6-14-11-27-12-21-14/h4-5,8,11-12,15H,6-7,9-10H2,1-3H3,(H,20,24)/t15-/m1/s1 |
| InChIKey | NFVAXCDHNOHPGR-OAHLLOKOSA-N |
| XLogP | 1.79 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |