C16H16ClNO — CID 95561817
(2R,5R)-5-(chloromethyl)-2,3-diphenyl-1,3-oxazolidine (PubChem CID 95561817) has the molecular formula C16H16ClNO and a molecular weight of 273.76 g/mol. Its IUPAC name is (2R,5R)-5-(chloromethyl)-2,3-diphenyl-1,3-oxazolidine.
| Compound Name | (2R,5R)-5-(chloromethyl)-2,3-diphenyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 95561817 |
| Molecular Formula | C16H16ClNO |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | (2R,5R)-5-(chloromethyl)-2,3-diphenyl-1,3-oxazolidine |
| SMILES | ClC[C@H]1CN(c2ccccc2)[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C16H16ClNO/c17-11-15-12-18(14-9-5-2-6-10-14)16(19-15)13-7-3-1-4-8-13/h1-10,15-16H,11-12H2/t15-,16+/m0/s1 |
| InChIKey | ZPFDYYPRWQDRTQ-JKSUJKDBSA-N |
| XLogP | 3.83 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|