About (2R,5R)-2-ethyl-2-methyl-5-(trichloromethyl)-1,3-oxazolidin-4-one
(2R,5R)-2-ethyl-2-methyl-5-(trichloromethyl)-1,3-oxazolidin-4-one (PubChem CID 95562004) has the molecular formula C7H10Cl3NO2
and a molecular weight of 246.52 g/mol. Its IUPAC name is (2R,5R)-2-ethyl-2-methyl-5-(trichloromethyl)-1,3-oxazolidin-4-one.
Molecular Properties
| Compound Name | (2R,5R)-2-ethyl-2-methyl-5-(trichloromethyl)-1,3-oxazolidin-4-one |
| PubChem CID | 95562004 |
| Molecular Formula | C7H10Cl3NO2 |
| Molecular Weight | 246.52 g/mol |
| Exact Mass | 244.98 |
| IUPAC Name | (2R,5R)-2-ethyl-2-methyl-5-(trichloromethyl)-1,3-oxazolidin-4-one |
| SMILES | CC[C@]1(C)NC(=O)[C@H](C(Cl)(Cl)Cl)O1 |
| InChI | InChI=1S/C7H10Cl3NO2/c1-3-6(2)11-5(12)4(13-6)7(8,9)10/h4H,3H2,1-2H3,(H,11,12)/t4-,6-/m1/s1 |
| InChIKey | LGAGUEXDOQZRKH-INEUFUBQSA-N |
| XLogP | 2.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.52 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2R,5R)-2-ethyl-2-methyl-5-(trichloromethyl)-1,3-oxazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5R)-2-ethyl-2-methyl-5-(trichloromethyl)-1,3-oxazolidin-4-one?
The IUPAC name of (2R,5R)-2-ethyl-2-methyl-5-(trichloromethyl)-1,3-oxazolidin-4-one (CID 95562004) is (2R,5R)-2-ethyl-2-methyl-5-(trichloromethyl)-1,3-oxazolidin-4-one.
What is the SMILES notation for (2R,5R)-2-ethyl-2-methyl-5-(trichloromethyl)-1,3-oxazolidin-4-one?
The canonical SMILES for (2R,5R)-2-ethyl-2-methyl-5-(trichloromethyl)-1,3-oxazolidin-4-one is CC[C@]1(C)NC(=O)[C@H](C(Cl)(Cl)Cl)O1.
What is the InChIKey of (2R,5R)-2-ethyl-2-methyl-5-(trichloromethyl)-1,3-oxazolidin-4-one?
The InChIKey is LGAGUEXDOQZRKH-INEUFUBQSA-N. The full InChI is InChI=1S/C7H10Cl3NO2/c1-3-6(2)11-5(12)4(13-6)7(8,9)10/h4H,3H2,1-2H3,(H,11,12)/t4-,6-/m1/s1.
What are the key properties of (2R,5R)-2-ethyl-2-methyl-5-(trichloromethyl)-1,3-oxazolidin-4-one?
(2R,5R)-2-ethyl-2-methyl-5-(trichloromethyl)-1,3-oxazolidin-4-one has a molecular weight of 246.52 g/mol, XLogP of 2.00, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5R)-2-ethyl-2-methyl-5-(trichloromethyl)-1,3-oxazolidin-4-one is sourced from PubChem (CID 95562004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).