C12H19NO16S2 — CID 95562957
(2R,3R,4S)-2-[(2R,3S,4R,5R,6R)-5-amino-4,6-dihydroxy-2-(sulfooxymethyl)oxan-3-yl]oxy-4-hydroxy-3-sulfooxy-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 95562957) has the molecular formula C12H19NO16S2 and a molecular weight of 497.41 g/mol. Its IUPAC name is (2R,3R,4S)-2-[(2R,3S,4R,5R,6R)-5-amino-4,6-dihydroxy-2-(sulfooxymethyl)oxan-3-yl]oxy-4-hydroxy-3-sulfooxy-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2R,3R,4S)-2-[(2R,3S,4R,5R,6R)-5-amino-4,6-dihydroxy-2-(sulfooxymethyl)oxan-3-yl]oxy-4-hydroxy-3-sulfooxy-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 95562957 |
| Molecular Formula | C12H19NO16S2 |
| Molecular Weight | 497.41 g/mol |
| Exact Mass | 497.01 |
| IUPAC Name | (2R,3R,4S)-2-[(2R,3S,4R,5R,6R)-5-amino-4,6-dihydroxy-2-(sulfooxymethyl)oxan-3-yl]oxy-4-hydroxy-3-sulfooxy-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | N[C@@H]1[C@@H](O)[C@H](O[C@@H]2OC(C(=O)O)=C[C@H](O)[C@H]2OS(=O)(=O)O)[C@@H](COS(=O)(=O)O)O[C@H]1O |
| InChI | InChI=1S/C12H19NO16S2/c13-6-7(15)9(5(26-11(6)18)2-25-30(19,20)21)28-12-8(29-31(22,23)24)3(14)1-4(27-12)10(16)17/h1,3,5-9,11-12,14-15,18H,2,13H2,(H,16,17)(H,19,20,21)(H,22,23,24)/t3-,5+,6+,7+,8+,9+,11+,12-/m0/s1 |
| InChIKey | IPIISWBJBJSFEJ-VNBYMBLMSA-N |
| XLogP | -4.53 |
| TPSA | 278.90 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.41 |
| LogP ≤ 5 | -4.53 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|