C24H28N4O2 — CID 95563342
(3S)-N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-5-oxo-1-(pyridin-3-ylmethyl)pyrrolidine-3-carboxamide (PubChem CID 95563342) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is (3S)-N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-5-oxo-1-(pyridin-3-ylmethyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-5-oxo-1-(pyridin-3-ylmethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 95563342 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | (3S)-N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-5-oxo-1-(pyridin-3-ylmethyl)pyrrolidine-3-carboxamide |
| SMILES | CCc1[nH]c2c(CNC(=O)[C@H]3CC(=O)N(Cc4cccnc4)C3)cc(C)cc2c1C |
| InChI | InChI=1S/C24H28N4O2/c1-4-21-16(3)20-9-15(2)8-18(23(20)27-21)12-26-24(30)19-10-22(29)28(14-19)13-17-6-5-7-25-11-17/h5-9,11,19,27H,4,10,12-14H2,1-3H3,(H,26,30)/t19-/m0/s1 |
| InChIKey | IBFFQLDMLGXRAP-IBGZPJMESA-N |
| XLogP | 3.41 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|