C22H20 — CID 95564671
(2R)-2,6-diphenyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 95564671) has the molecular formula C22H20 and a molecular weight of 284.40 g/mol. Its IUPAC name is (2R)-2,6-diphenyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | (2R)-2,6-diphenyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 95564671 |
| Molecular Formula | C22H20 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (2R)-2,6-diphenyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | c1ccc(-c2ccc3c(c2)CC[C@@H](c2ccccc2)C3)cc1 |
| InChI | InChI=1S/C22H20/c1-3-7-17(8-4-1)19-11-13-22-16-20(12-14-21(22)15-19)18-9-5-2-6-10-18/h1-11,13,15,20H,12,14,16H2/t20-/m1/s1 |
| InChIKey | JVGWZNOZWQFRRU-HXUWFJFHSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |