About (3aS)-6-bromo-1,2,3,3a,4,5-hexahydropentalene
(3aS)-6-bromo-1,2,3,3a,4,5-hexahydropentalene (PubChem CID 95565171) has the molecular formula C8H11Br
and a molecular weight of 187.08 g/mol. Its IUPAC name is (3aS)-6-bromo-1,2,3,3a,4,5-hexahydropentalene.
Analyze (3aS)-6-bromo-1,2,3,3a,4,5-hexahydropentalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3aS)-6-bromo-1,2,3,3a,4,5-hexahydropentalene?
The IUPAC name of (3aS)-6-bromo-1,2,3,3a,4,5-hexahydropentalene (CID 95565171) is (3aS)-6-bromo-1,2,3,3a,4,5-hexahydropentalene.
What is the SMILES notation for (3aS)-6-bromo-1,2,3,3a,4,5-hexahydropentalene?
The canonical SMILES for (3aS)-6-bromo-1,2,3,3a,4,5-hexahydropentalene is BrC1=C2CCC[C@H]2CC1.
What is the InChIKey of (3aS)-6-bromo-1,2,3,3a,4,5-hexahydropentalene?
The InChIKey is FNCMNVJZDPKOOJ-LURJTMIESA-N. The full InChI is InChI=1S/C8H11Br/c9-8-5-4-6-2-1-3-7(6)8/h6H,1-5H2/t6-/m0/s1.
What are the key properties of (3aS)-6-bromo-1,2,3,3a,4,5-hexahydropentalene?
(3aS)-6-bromo-1,2,3,3a,4,5-hexahydropentalene has a molecular weight of 187.08 g/mol, XLogP of 3.23, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3aS)-6-bromo-1,2,3,3a,4,5-hexahydropentalene is sourced from PubChem (CID 95565171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).