C13H18O2 — CID 95565178
(4aS,8aR)-8a-ethenyl-3,4a-dimethyl-5,6,7,8-tetrahydrochromen-2-one (PubChem CID 95565178) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is (4aS,8aR)-8a-ethenyl-3,4a-dimethyl-5,6,7,8-tetrahydrochromen-2-one.
| Compound Name | (4aS,8aR)-8a-ethenyl-3,4a-dimethyl-5,6,7,8-tetrahydrochromen-2-one |
|---|---|
| PubChem CID | 95565178 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (4aS,8aR)-8a-ethenyl-3,4a-dimethyl-5,6,7,8-tetrahydrochromen-2-one |
| SMILES | C=C[C@]12CCCC[C@@]1(C)C=C(C)C(=O)O2 |
| InChI | InChI=1S/C13H18O2/c1-4-13-8-6-5-7-12(13,3)9-10(2)11(14)15-13/h4,9H,1,5-8H2,2-3H3/t12-,13-/m0/s1 |
| InChIKey | WJNKCBPRBGPVFI-STQMWFEESA-N |
| XLogP | 2.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|