C21H34O3 — CID 95565305
(3R,3aR,5aR,8S,9R,9aR,9bS)-3-methoxy-3a,8,9a-trimethyl-9-(3-oxobutyl)-1,2,3,5,5a,6,7,8,9,9b-decahydrocyclopenta[a]naphthalen-4-one (PubChem CID 95565305) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is (3R,3aR,5aR,8S,9R,9aR,9bS)-3-methoxy-3a,8,9a-trimethyl-9-(3-oxobutyl)-1,2,3,5,5a,6,7,8,9,9b-decahydrocyclopenta[a]naphthalen-4-one.
| Compound Name | (3R,3aR,5aR,8S,9R,9aR,9bS)-3-methoxy-3a,8,9a-trimethyl-9-(3-oxobutyl)-1,2,3,5,5a,6,7,8,9,9b-decahydrocyclopenta[a]naphthalen-4-one |
|---|---|
| PubChem CID | 95565305 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | (3R,3aR,5aR,8S,9R,9aR,9bS)-3-methoxy-3a,8,9a-trimethyl-9-(3-oxobutyl)-1,2,3,5,5a,6,7,8,9,9b-decahydrocyclopenta[a]naphthalen-4-one |
| SMILES | CO[C@@H]1CC[C@@H]2[C@@]1(C)C(=O)C[C@H]1CC[C@H](C)[C@@H](CCC(C)=O)[C@@]12C |
| InChI | InChI=1S/C21H34O3/c1-13-6-8-15-12-18(23)21(4)17(10-11-19(21)24-5)20(15,3)16(13)9-7-14(2)22/h13,15-17,19H,6-12H2,1-5H3/t13-,15+,16+,17-,19+,20+,21-/m0/s1 |
| InChIKey | PHAJXBJNUVKPBE-NHGIHJHGSA-N |
| XLogP | 4.43 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |