C13H20O — CID 95565361
(1S,2R,5S,8S,9R)-5,9-dimethyltricyclo[6.3.0.01,5]undec-3-en-2-ol (PubChem CID 95565361) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is (1S,2R,5S,8S,9R)-5,9-dimethyltricyclo[6.3.0.01,5]undec-3-en-2-ol.
| Compound Name | (1S,2R,5S,8S,9R)-5,9-dimethyltricyclo[6.3.0.01,5]undec-3-en-2-ol |
|---|---|
| PubChem CID | 95565361 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | (1S,2R,5S,8S,9R)-5,9-dimethyltricyclo[6.3.0.01,5]undec-3-en-2-ol |
| SMILES | C[C@@H]1CC[C@@]23[C@H](O)C=C[C@]2(C)CC[C@@H]13 |
| InChI | InChI=1S/C13H20O/c1-9-3-8-13-10(9)4-6-12(13,2)7-5-11(13)14/h5,7,9-11,14H,3-4,6,8H2,1-2H3/t9-,10+,11-,12+,13-/m1/s1 |
| InChIKey | SEJBLZONSIHCLJ-RXGFPQBGSA-N |
| XLogP | 2.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|