C17H30O6S — CID 95565492
methyl (1S,3aS,4S,5R,7aS)-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-5-methylsulfonyloxy-1,2,3,3a,4,5,6,7-octahydroindene-4-carboxylate (PubChem CID 95565492) has the molecular formula C17H30O6S and a molecular weight of 362.49 g/mol. Its IUPAC name is methyl (1S,3aS,4S,5R,7aS)-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-5-methylsulfonyloxy-1,2,3,3a,4,5,6,7-octahydroindene-4-carboxylate.
| Compound Name | methyl (1S,3aS,4S,5R,7aS)-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-5-methylsulfonyloxy-1,2,3,3a,4,5,6,7-octahydroindene-4-carboxylate |
|---|---|
| PubChem CID | 95565492 |
| Molecular Formula | C17H30O6S |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | methyl (1S,3aS,4S,5R,7aS)-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-5-methylsulfonyloxy-1,2,3,3a,4,5,6,7-octahydroindene-4-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](OS(C)(=O)=O)CC[C@]2(C)[C@@H](OC(C)(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C17H30O6S/c1-16(2,3)22-13-8-7-11-14(15(18)21-5)12(23-24(6,19)20)9-10-17(11,13)4/h11-14H,7-10H2,1-6H3/t11-,12+,13-,14-,17-/m0/s1 |
| InChIKey | CNZCUGBMRKLKDP-WLZFUECHSA-N |
| XLogP | 2.51 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|