C15H24O4 — CID 95565675
(3aR,4R,6aR)-3a-hydroxy-4-methyl-2,3-di(propan-2-yloxy)-4,5,6,6a-tetrahydropentalen-1-one (PubChem CID 95565675) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (3aR,4R,6aR)-3a-hydroxy-4-methyl-2,3-di(propan-2-yloxy)-4,5,6,6a-tetrahydropentalen-1-one.
| Compound Name | (3aR,4R,6aR)-3a-hydroxy-4-methyl-2,3-di(propan-2-yloxy)-4,5,6,6a-tetrahydropentalen-1-one |
|---|---|
| PubChem CID | 95565675 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (3aR,4R,6aR)-3a-hydroxy-4-methyl-2,3-di(propan-2-yloxy)-4,5,6,6a-tetrahydropentalen-1-one |
| SMILES | CC(C)OC1=C(OC(C)C)[C@@]2(O)[C@H](C)CC[C@H]2C1=O |
| InChI | InChI=1S/C15H24O4/c1-8(2)18-13-12(16)11-7-6-10(5)15(11,17)14(13)19-9(3)4/h8-11,17H,6-7H2,1-5H3/t10-,11+,15-/m1/s1 |
| InChIKey | QLCVVKQSTFHRLR-JRPNMDOOSA-N |
| XLogP | 2.41 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |