About CID 95565689
CID 95565689 (PubChem CID 95565689) has the molecular formula C14H14O2
and a molecular weight of 214.26 g/mol.
Molecular Properties
| Compound Name | CID 95565689 |
| PubChem CID | 95565689 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | — |
| SMILES | O=C1C=C[C@@]2(CO2)[C@@H]2[C@H]1[C@@H]1C=C[C@H]2C12CC2 |
| InChI | InChI=1S/C14H14O2/c15-10-3-4-14(7-16-14)12-9-2-1-8(11(10)12)13(9)5-6-13/h1-4,8-9,11-12H,5-7H2/t8-,9+,11-,12-,14+/m0/s1 |
| InChIKey | QZMWTKATHSHJJI-BMOFAUNVSA-N |
| XLogP | 1.72 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze CID 95565689 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 95565689?
The IUPAC name of CID 95565689 (CID 95565689) is not available.
What is the SMILES notation for CID 95565689?
The canonical SMILES for CID 95565689 is O=C1C=C[C@@]2(CO2)[C@@H]2[C@H]1[C@@H]1C=C[C@H]2C12CC2.
What is the InChIKey of CID 95565689?
The InChIKey is QZMWTKATHSHJJI-BMOFAUNVSA-N. The full InChI is InChI=1S/C14H14O2/c15-10-3-4-14(7-16-14)12-9-2-1-8(11(10)12)13(9)5-6-13/h1-4,8-9,11-12H,5-7H2/t8-,9+,11-,12-,14+/m0/s1.
What are the key properties of CID 95565689?
CID 95565689 has a molecular weight of 214.26 g/mol, XLogP of 1.72, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 95565689 is sourced from PubChem (CID 95565689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).