C26H22O2 — CID 95565697
(4R,8R,9S)-spiro[hexacyclo[10.6.6.02,11.04,9.013,18.019,24]tetracosa-2(11),6,13,15,17,19,21,23-octaene-8,2'-oxetane]-5-one (PubChem CID 95565697) has the molecular formula C26H22O2 and a molecular weight of 366.46 g/mol. Its IUPAC name is (4R,8R,9S)-spiro[hexacyclo[10.6.6.02,11.04,9.013,18.019,24]tetracosa-2(11),6,13,15,17,19,21,23-octaene-8,2'-oxetane]-5-one.
| Compound Name | (4R,8R,9S)-spiro[hexacyclo[10.6.6.02,11.04,9.013,18.019,24]tetracosa-2(11),6,13,15,17,19,21,23-octaene-8,2'-oxetane]-5-one |
|---|---|
| PubChem CID | 95565697 |
| Molecular Formula | C26H22O2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | (4R,8R,9S)-spiro[hexacyclo[10.6.6.02,11.04,9.013,18.019,24]tetracosa-2(11),6,13,15,17,19,21,23-octaene-8,2'-oxetane]-5-one |
| SMILES | O=C1C=C[C@]2(CCO2)[C@H]2CC3=C(C[C@@H]12)C1c2ccccc2C3c2ccccc21 |
| InChI | InChI=1S/C26H22O2/c27-23-9-10-26(11-12-28-26)22-14-20-19(13-21(22)23)24-15-5-1-3-7-17(15)25(20)18-8-4-2-6-16(18)24/h1-10,21-22,24-25H,11-14H2/t21-,22+,24?,25?,26+/m1/s1 |
| InChIKey | SIZGVHJUKQTSOI-NSCDMFKISA-N |
| XLogP | 4.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|