C23H33N3O2 — CID 95565744
4-[[(1R,4aR,10aR)-1,4a,10a-trimethyl-7-propan-2-yl-3,4,9,10-tetrahydro-2H-phenanthren-1-yl]methyl]-1,2,4-triazolidine-3,5-dione (PubChem CID 95565744) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is 4-[[(1R,4aR,10aR)-1,4a,10a-trimethyl-7-propan-2-yl-3,4,9,10-tetrahydro-2H-phenanthren-1-yl]methyl]-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-[[(1R,4aR,10aR)-1,4a,10a-trimethyl-7-propan-2-yl-3,4,9,10-tetrahydro-2H-phenanthren-1-yl]methyl]-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 95565744 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | 4-[[(1R,4aR,10aR)-1,4a,10a-trimethyl-7-propan-2-yl-3,4,9,10-tetrahydro-2H-phenanthren-1-yl]methyl]-1,2,4-triazolidine-3,5-dione |
| SMILES | CC(C)c1ccc2c(c1)CC[C@@]1(C)[C@](C)(Cn3c(=O)[nH][nH]c3=O)CCC[C@@]21C |
| InChI | InChI=1S/C23H33N3O2/c1-15(2)16-7-8-18-17(13-16)9-12-23(5)21(3,10-6-11-22(18,23)4)14-26-19(27)24-25-20(26)28/h7-8,13,15H,6,9-12,14H2,1-5H3,(H,24,27)(H,25,28)/t21-,22-,23-/m0/s1 |
| InChIKey | PUXQOFKFPPRFAF-VABKMULXSA-N |
| XLogP | 4.09 |
| TPSA | 70.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |