C17H25NO2S — CID 95565761
(2R,3aR,4S,6aR)-4-methyl-2-[(N-methyl-S-phenylsulfonimidoyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ol (PubChem CID 95565761) has the molecular formula C17H25NO2S and a molecular weight of 307.46 g/mol. Its IUPAC name is (2R,3aR,4S,6aR)-4-methyl-2-[(N-methyl-S-phenylsulfonimidoyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ol.
| Compound Name | (2R,3aR,4S,6aR)-4-methyl-2-[(N-methyl-S-phenylsulfonimidoyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ol |
|---|---|
| PubChem CID | 95565761 |
| Molecular Formula | C17H25NO2S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (2R,3aR,4S,6aR)-4-methyl-2-[(N-methyl-S-phenylsulfonimidoyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ol |
| SMILES | CN=[S@@](=O)(C[C@@]1(O)C[C@H]2CC[C@H](C)[C@H]2C1)c1ccccc1 |
| InChI | InChI=1S/C17H25NO2S/c1-13-8-9-14-10-17(19,11-16(13)14)12-21(20,18-2)15-6-4-3-5-7-15/h3-7,13-14,16,19H,8-12H2,1-2H3/t13-,14+,16+,17+,21+/m0/s1 |
| InChIKey | PTXGOHHCWLVWGS-QMBVYZDCSA-N |
| XLogP | 3.33 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |