About (3S)-3,5,7-trimethyl-1-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]-3H-azepin-2-one
(3S)-3,5,7-trimethyl-1-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]-3H-azepin-2-one (PubChem CID 95565823) has the molecular formula C17H29N2O+
and a molecular weight of 277.43 g/mol. Its IUPAC name is (3S)-3,5,7-trimethyl-1-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]-3H-azepin-2-one.
Molecular Properties
| Compound Name | (3S)-3,5,7-trimethyl-1-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]-3H-azepin-2-one |
| PubChem CID | 95565823 |
| Molecular Formula | C17H29N2O+ |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.23 |
| IUPAC Name | (3S)-3,5,7-trimethyl-1-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]-3H-azepin-2-one |
| SMILES | CC1=C[C@H](C)C(=O)N(CC[N+]2(C)CCCCC2)C(C)=C1 |
| InChI | InChI=1S/C17H29N2O/c1-14-12-15(2)17(20)18(16(3)13-14)8-11-19(4)9-6-5-7-10-19/h12-13,15H,5-11H2,1-4H3/q+1/t15-/m0/s1 |
| InChIKey | RCGHBQFTZJLBAY-HNNXBMFYSA-N |
| XLogP | 2.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3,5,7-trimethyl-1-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]-3H-azepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3,5,7-trimethyl-1-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]-3H-azepin-2-one?
The IUPAC name of (3S)-3,5,7-trimethyl-1-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]-3H-azepin-2-one (CID 95565823) is (3S)-3,5,7-trimethyl-1-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]-3H-azepin-2-one.
What is the SMILES notation for (3S)-3,5,7-trimethyl-1-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]-3H-azepin-2-one?
The canonical SMILES for (3S)-3,5,7-trimethyl-1-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]-3H-azepin-2-one is CC1=C[C@H](C)C(=O)N(CC[N+]2(C)CCCCC2)C(C)=C1.
What is the InChIKey of (3S)-3,5,7-trimethyl-1-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]-3H-azepin-2-one?
The InChIKey is RCGHBQFTZJLBAY-HNNXBMFYSA-N. The full InChI is InChI=1S/C17H29N2O/c1-14-12-15(2)17(20)18(16(3)13-14)8-11-19(4)9-6-5-7-10-19/h12-13,15H,5-11H2,1-4H3/q+1/t15-/m0/s1.
What are the key properties of (3S)-3,5,7-trimethyl-1-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]-3H-azepin-2-one?
(3S)-3,5,7-trimethyl-1-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]-3H-azepin-2-one has a molecular weight of 277.43 g/mol, XLogP of 2.95, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3,5,7-trimethyl-1-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]-3H-azepin-2-one is sourced from PubChem (CID 95565823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).