C17H27NO5S — CID 95566212
(E)-7-[(2R)-2-carboxypropyl]sulfanyl-2-[[(1S)-2,2-dimethylcyclopropanecarbonyl]amino]hept-2-enoic acid (PubChem CID 95566212) has the molecular formula C17H27NO5S and a molecular weight of 357.47 g/mol. Its IUPAC name is (E)-7-[(2R)-2-carboxypropyl]sulfanyl-2-[[(1S)-2,2-dimethylcyclopropanecarbonyl]amino]hept-2-enoic acid.
| Compound Name | (E)-7-[(2R)-2-carboxypropyl]sulfanyl-2-[[(1S)-2,2-dimethylcyclopropanecarbonyl]amino]hept-2-enoic acid |
|---|---|
| PubChem CID | 95566212 |
| Molecular Formula | C17H27NO5S |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | (E)-7-[(2R)-2-carboxypropyl]sulfanyl-2-[[(1S)-2,2-dimethylcyclopropanecarbonyl]amino]hept-2-enoic acid |
| SMILES | C[C@@H](CSCCCC/C=C(/NC(=O)[C@H]1CC1(C)C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C17H27NO5S/c1-11(15(20)21)10-24-8-6-4-5-7-13(16(22)23)18-14(19)12-9-17(12,2)3/h7,11-12H,4-6,8-10H2,1-3H3,(H,18,19)(H,20,21)(H,22,23)/b13-7+/t11-,12+/m0/s1 |
| InChIKey | RROJUBDNJOLIIH-BXGWELLUSA-N |
| XLogP | 2.74 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|