About (1S,3R)-1-oxothiolan-3-amine
(1S,3R)-1-oxothiolan-3-amine (PubChem CID 95566573) has the molecular formula C4H9NOS
and a molecular weight of 119.19 g/mol. Its IUPAC name is (1S,3R)-1-oxothiolan-3-amine.
Molecular Properties
| Compound Name | (1S,3R)-1-oxothiolan-3-amine |
| PubChem CID | 95566573 |
| Molecular Formula | C4H9NOS |
| Molecular Weight | 119.19 g/mol |
| Exact Mass | 119.04 |
| IUPAC Name | (1S,3R)-1-oxothiolan-3-amine |
| SMILES | N[C@@H]1CC[S@](=O)C1 |
| InChI | InChI=1S/C4H9NOS/c5-4-1-2-7(6)3-4/h4H,1-3,5H2/t4-,7+/m1/s1 |
| InChIKey | IZIQAJJTLDOLGI-FBCQKBJTSA-N |
| XLogP | -0.53 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.19 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S,3R)-1-oxothiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,3R)-1-oxothiolan-3-amine?
The IUPAC name of (1S,3R)-1-oxothiolan-3-amine (CID 95566573) is (1S,3R)-1-oxothiolan-3-amine.
What is the SMILES notation for (1S,3R)-1-oxothiolan-3-amine?
The canonical SMILES for (1S,3R)-1-oxothiolan-3-amine is N[C@@H]1CC[S@](=O)C1.
What is the InChIKey of (1S,3R)-1-oxothiolan-3-amine?
The InChIKey is IZIQAJJTLDOLGI-FBCQKBJTSA-N. The full InChI is InChI=1S/C4H9NOS/c5-4-1-2-7(6)3-4/h4H,1-3,5H2/t4-,7+/m1/s1.
What are the key properties of (1S,3R)-1-oxothiolan-3-amine?
(1S,3R)-1-oxothiolan-3-amine has a molecular weight of 119.19 g/mol, XLogP of -0.53, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,3R)-1-oxothiolan-3-amine is sourced from PubChem (CID 95566573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).