C15H22ClN3O2S — CID 95568313
1-[(2S)-2-[(5-chlorothiophen-2-yl)methyl-methylamino]propanoyl]piperidine-4-carboxamide (PubChem CID 95568313) has the molecular formula C15H22ClN3O2S and a molecular weight of 343.88 g/mol. Its IUPAC name is 1-[(2S)-2-[(5-chlorothiophen-2-yl)methyl-methylamino]propanoyl]piperidine-4-carboxamide.
| Compound Name | 1-[(2S)-2-[(5-chlorothiophen-2-yl)methyl-methylamino]propanoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 95568313 |
| Molecular Formula | C15H22ClN3O2S |
| Molecular Weight | 343.88 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 1-[(2S)-2-[(5-chlorothiophen-2-yl)methyl-methylamino]propanoyl]piperidine-4-carboxamide |
| SMILES | C[C@@H](C(=O)N1CCC(C(N)=O)CC1)N(C)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C15H22ClN3O2S/c1-10(18(2)9-12-3-4-13(16)22-12)15(21)19-7-5-11(6-8-19)14(17)20/h3-4,10-11H,5-9H2,1-2H3,(H2,17,20)/t10-/m0/s1 |
| InChIKey | RINZQFSKYVCDDE-JTQLQIEISA-N |
| XLogP | 1.95 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.88 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |