C15H17N5OS — CID 95569836
N-(3-cyanothiophen-2-yl)-2-[(2S)-2-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]acetamide (PubChem CID 95569836) has the molecular formula C15H17N5OS and a molecular weight of 315.40 g/mol. Its IUPAC name is N-(3-cyanothiophen-2-yl)-2-[(2S)-2-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]acetamide.
| Compound Name | N-(3-cyanothiophen-2-yl)-2-[(2S)-2-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 95569836 |
| Molecular Formula | C15H17N5OS |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | N-(3-cyanothiophen-2-yl)-2-[(2S)-2-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]acetamide |
| SMILES | Cn1cc([C@@H]2CCCN2CC(=O)Nc2sccc2C#N)cn1 |
| InChI | InChI=1S/C15H17N5OS/c1-19-9-12(8-17-19)13-3-2-5-20(13)10-14(21)18-15-11(7-16)4-6-22-15/h4,6,8-9,13H,2-3,5,10H2,1H3,(H,18,21)/t13-/m0/s1 |
| InChIKey | BHQIRRVMPVKQHV-ZDUSSCGKSA-N |
| XLogP | 2.13 |
| TPSA | 73.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |