C23H26N2O2 — CID 95570542
1-cyclopropyl-1-(2-hydroxyethyl)-3-[[(15S)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]urea (PubChem CID 95570542) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is 1-cyclopropyl-1-(2-hydroxyethyl)-3-[[(15S)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]urea.
| Compound Name | 1-cyclopropyl-1-(2-hydroxyethyl)-3-[[(15S)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]urea |
|---|---|
| PubChem CID | 95570542 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 1-cyclopropyl-1-(2-hydroxyethyl)-3-[[(15S)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]urea |
| SMILES | O=C(NC[C@H]1CC2c3ccccc3C1c1ccccc12)N(CCO)C1CC1 |
| InChI | InChI=1S/C23H26N2O2/c26-12-11-25(16-9-10-16)23(27)24-14-15-13-21-17-5-1-3-7-19(17)22(15)20-8-4-2-6-18(20)21/h1-8,15-16,21-22,26H,9-14H2,(H,24,27)/t15-,21?,22?/m1/s1 |
| InChIKey | YMHCLKGMQJXBAS-IYJORBIASA-N |
| XLogP | 3.45 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |