C20H26N4O — CID 95570929
1-[[(3S)-1-(2-phenylethyl)pyrrolidin-3-yl]methyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 95570929) has the molecular formula C20H26N4O and a molecular weight of 338.46 g/mol. Its IUPAC name is 1-[[(3S)-1-(2-phenylethyl)pyrrolidin-3-yl]methyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[[(3S)-1-(2-phenylethyl)pyrrolidin-3-yl]methyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 95570929 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 1-[[(3S)-1-(2-phenylethyl)pyrrolidin-3-yl]methyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | O=C(NCc1cccnc1)NC[C@@H]1CCN(CCc2ccccc2)C1 |
| InChI | InChI=1S/C20H26N4O/c25-20(22-14-18-7-4-10-21-13-18)23-15-19-9-12-24(16-19)11-8-17-5-2-1-3-6-17/h1-7,10,13,19H,8-9,11-12,14-16H2,(H2,22,23,25)/t19-/m0/s1 |
| InChIKey | DGISLJJYNVFRCL-IBGZPJMESA-N |
| XLogP | 2.45 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |