About 1-methyl-3-[[(1S,3R)-3-methylcyclohexyl]methyl]-1-[(1-methylpiperidin-4-yl)methyl]urea
1-methyl-3-[[(1S,3R)-3-methylcyclohexyl]methyl]-1-[(1-methylpiperidin-4-yl)methyl]urea (PubChem CID 95572797) has the molecular formula C17H33N3O
and a molecular weight of 295.47 g/mol. Its IUPAC name is 1-methyl-3-[[(1S,3R)-3-methylcyclohexyl]methyl]-1-[(1-methylpiperidin-4-yl)methyl]urea.
Molecular Properties
| Compound Name | 1-methyl-3-[[(1S,3R)-3-methylcyclohexyl]methyl]-1-[(1-methylpiperidin-4-yl)methyl]urea |
| PubChem CID | 95572797 |
| Molecular Formula | C17H33N3O |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.26 |
| IUPAC Name | 1-methyl-3-[[(1S,3R)-3-methylcyclohexyl]methyl]-1-[(1-methylpiperidin-4-yl)methyl]urea |
| SMILES | C[C@@H]1CCC[C@H](CNC(=O)N(C)CC2CCN(C)CC2)C1 |
| InChI | InChI=1S/C17H33N3O/c1-14-5-4-6-16(11-14)12-18-17(21)20(3)13-15-7-9-19(2)10-8-15/h14-16H,4-13H2,1-3H3,(H,18,21)/t14-,16+/m1/s1 |
| InChIKey | IJAAWNWLOOADRG-ZBFHGGJFSA-N |
| XLogP | 2.80 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methyl-3-[[(1S,3R)-3-methylcyclohexyl]methyl]-1-[(1-methylpiperidin-4-yl)methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-[[(1S,3R)-3-methylcyclohexyl]methyl]-1-[(1-methylpiperidin-4-yl)methyl]urea?
The IUPAC name of 1-methyl-3-[[(1S,3R)-3-methylcyclohexyl]methyl]-1-[(1-methylpiperidin-4-yl)methyl]urea (CID 95572797) is 1-methyl-3-[[(1S,3R)-3-methylcyclohexyl]methyl]-1-[(1-methylpiperidin-4-yl)methyl]urea.
What is the SMILES notation for 1-methyl-3-[[(1S,3R)-3-methylcyclohexyl]methyl]-1-[(1-methylpiperidin-4-yl)methyl]urea?
The canonical SMILES for 1-methyl-3-[[(1S,3R)-3-methylcyclohexyl]methyl]-1-[(1-methylpiperidin-4-yl)methyl]urea is C[C@@H]1CCC[C@H](CNC(=O)N(C)CC2CCN(C)CC2)C1.
What is the InChIKey of 1-methyl-3-[[(1S,3R)-3-methylcyclohexyl]methyl]-1-[(1-methylpiperidin-4-yl)methyl]urea?
The InChIKey is IJAAWNWLOOADRG-ZBFHGGJFSA-N. The full InChI is InChI=1S/C17H33N3O/c1-14-5-4-6-16(11-14)12-18-17(21)20(3)13-15-7-9-19(2)10-8-15/h14-16H,4-13H2,1-3H3,(H,18,21)/t14-,16+/m1/s1.
What are the key properties of 1-methyl-3-[[(1S,3R)-3-methylcyclohexyl]methyl]-1-[(1-methylpiperidin-4-yl)methyl]urea?
1-methyl-3-[[(1S,3R)-3-methylcyclohexyl]methyl]-1-[(1-methylpiperidin-4-yl)methyl]urea has a molecular weight of 295.47 g/mol, XLogP of 2.80, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-[[(1S,3R)-3-methylcyclohexyl]methyl]-1-[(1-methylpiperidin-4-yl)methyl]urea is sourced from PubChem (CID 95572797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).