About 2-[4-[(1S,2R)-2-ethoxycyclopropanecarbonyl]piperazin-1-yl]pyridine-4-carbonitrile
2-[4-[(1S,2R)-2-ethoxycyclopropanecarbonyl]piperazin-1-yl]pyridine-4-carbonitrile (PubChem CID 95573247) has the molecular formula C16H20N4O2
and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-[4-[(1S,2R)-2-ethoxycyclopropanecarbonyl]piperazin-1-yl]pyridine-4-carbonitrile.
Molecular Properties
| Compound Name | 2-[4-[(1S,2R)-2-ethoxycyclopropanecarbonyl]piperazin-1-yl]pyridine-4-carbonitrile |
| PubChem CID | 95573247 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 2-[4-[(1S,2R)-2-ethoxycyclopropanecarbonyl]piperazin-1-yl]pyridine-4-carbonitrile |
| SMILES | CCO[C@@H]1C[C@@H]1C(=O)N1CCN(c2cc(C#N)ccn2)CC1 |
| InChI | InChI=1S/C16H20N4O2/c1-2-22-14-10-13(14)16(21)20-7-5-19(6-8-20)15-9-12(11-17)3-4-18-15/h3-4,9,13-14H,2,5-8,10H2,1H3/t13-,14+/m0/s1 |
| InChIKey | GLBYAPZKUDWDBM-UONOGXRCSA-N |
| XLogP | 1.03 |
| TPSA | 69.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-[(1S,2R)-2-ethoxycyclopropanecarbonyl]piperazin-1-yl]pyridine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(1S,2R)-2-ethoxycyclopropanecarbonyl]piperazin-1-yl]pyridine-4-carbonitrile?
The IUPAC name of 2-[4-[(1S,2R)-2-ethoxycyclopropanecarbonyl]piperazin-1-yl]pyridine-4-carbonitrile (CID 95573247) is 2-[4-[(1S,2R)-2-ethoxycyclopropanecarbonyl]piperazin-1-yl]pyridine-4-carbonitrile.
What is the SMILES notation for 2-[4-[(1S,2R)-2-ethoxycyclopropanecarbonyl]piperazin-1-yl]pyridine-4-carbonitrile?
The canonical SMILES for 2-[4-[(1S,2R)-2-ethoxycyclopropanecarbonyl]piperazin-1-yl]pyridine-4-carbonitrile is CCO[C@@H]1C[C@@H]1C(=O)N1CCN(c2cc(C#N)ccn2)CC1.
What is the InChIKey of 2-[4-[(1S,2R)-2-ethoxycyclopropanecarbonyl]piperazin-1-yl]pyridine-4-carbonitrile?
The InChIKey is GLBYAPZKUDWDBM-UONOGXRCSA-N. The full InChI is InChI=1S/C16H20N4O2/c1-2-22-14-10-13(14)16(21)20-7-5-19(6-8-20)15-9-12(11-17)3-4-18-15/h3-4,9,13-14H,2,5-8,10H2,1H3/t13-,14+/m0/s1.
What are the key properties of 2-[4-[(1S,2R)-2-ethoxycyclopropanecarbonyl]piperazin-1-yl]pyridine-4-carbonitrile?
2-[4-[(1S,2R)-2-ethoxycyclopropanecarbonyl]piperazin-1-yl]pyridine-4-carbonitrile has a molecular weight of 300.36 g/mol, XLogP of 1.03, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(1S,2R)-2-ethoxycyclopropanecarbonyl]piperazin-1-yl]pyridine-4-carbonitrile is sourced from PubChem (CID 95573247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).