C16H21N3O3 — CID 95575195
methyl 5-[[(3R)-3-(2-methylpyrazol-3-yl)piperidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 95575195) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is methyl 5-[[(3R)-3-(2-methylpyrazol-3-yl)piperidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(3R)-3-(2-methylpyrazol-3-yl)piperidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 95575195 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | methyl 5-[[(3R)-3-(2-methylpyrazol-3-yl)piperidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2CCC[C@@H](c3ccnn3C)C2)o1 |
| InChI | InChI=1S/C16H21N3O3/c1-18-14(7-8-17-18)12-4-3-9-19(10-12)11-13-5-6-15(22-13)16(20)21-2/h5-8,12H,3-4,9-11H2,1-2H3/t12-/m1/s1 |
| InChIKey | QJXXYDYHPOVQPV-GFCCVEGCSA-N |
| XLogP | 2.18 |
| TPSA | 60.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |