C16H21N3O2 — CID 95576414
(2S,4R)-2-methyl-1-[2-oxo-2-(prop-2-enylamino)ethyl]-3,4-dihydro-2H-quinoline-4-carboxamide (PubChem CID 95576414) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is (2S,4R)-2-methyl-1-[2-oxo-2-(prop-2-enylamino)ethyl]-3,4-dihydro-2H-quinoline-4-carboxamide.
| Compound Name | (2S,4R)-2-methyl-1-[2-oxo-2-(prop-2-enylamino)ethyl]-3,4-dihydro-2H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 95576414 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | (2S,4R)-2-methyl-1-[2-oxo-2-(prop-2-enylamino)ethyl]-3,4-dihydro-2H-quinoline-4-carboxamide |
| SMILES | C=CCNC(=O)CN1c2ccccc2[C@H](C(N)=O)C[C@@H]1C |
| InChI | InChI=1S/C16H21N3O2/c1-3-8-18-15(20)10-19-11(2)9-13(16(17)21)12-6-4-5-7-14(12)19/h3-7,11,13H,1,8-10H2,2H3,(H2,17,21)(H,18,20)/t11-,13+/m0/s1 |
| InChIKey | FGORUHWTHXZMEV-WCQYABFASA-N |
| XLogP | 1.16 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|