C19H22F2N2O2 — CID 95579560
(1R)-1-(2,4-difluorophenyl)-2-[(4-morpholin-4-ylphenyl)methylamino]ethanol (PubChem CID 95579560) has the molecular formula C19H22F2N2O2 and a molecular weight of 348.39 g/mol. Its IUPAC name is (1R)-1-(2,4-difluorophenyl)-2-[(4-morpholin-4-ylphenyl)methylamino]ethanol.
| Compound Name | (1R)-1-(2,4-difluorophenyl)-2-[(4-morpholin-4-ylphenyl)methylamino]ethanol |
|---|---|
| PubChem CID | 95579560 |
| Molecular Formula | C19H22F2N2O2 |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (1R)-1-(2,4-difluorophenyl)-2-[(4-morpholin-4-ylphenyl)methylamino]ethanol |
| SMILES | O[C@@H](CNCc1ccc(N2CCOCC2)cc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H22F2N2O2/c20-15-3-6-17(18(21)11-15)19(24)13-22-12-14-1-4-16(5-2-14)23-7-9-25-10-8-23/h1-6,11,19,22,24H,7-10,12-13H2/t19-/m0/s1 |
| InChIKey | UHYNEEFPYDLJMC-IBGZPJMESA-N |
| XLogP | 2.62 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|