C15H20N2O — CID 95584191
(2S,4S)-2-methyl-1-(2-methylprop-2-enyl)-3,4-dihydro-2H-quinoline-4-carboxamide (PubChem CID 95584191) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is (2S,4S)-2-methyl-1-(2-methylprop-2-enyl)-3,4-dihydro-2H-quinoline-4-carboxamide.
| Compound Name | (2S,4S)-2-methyl-1-(2-methylprop-2-enyl)-3,4-dihydro-2H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 95584191 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (2S,4S)-2-methyl-1-(2-methylprop-2-enyl)-3,4-dihydro-2H-quinoline-4-carboxamide |
| SMILES | C=C(C)CN1c2ccccc2[C@@H](C(N)=O)C[C@@H]1C |
| InChI | InChI=1S/C15H20N2O/c1-10(2)9-17-11(3)8-13(15(16)18)12-6-4-5-7-14(12)17/h4-7,11,13H,1,8-9H2,2-3H3,(H2,16,18)/t11-,13-/m0/s1 |
| InChIKey | JAMGHTHSNSMJGZ-AAEUAGOBSA-N |
| XLogP | 2.43 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|