About (1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-[(3R)-3-propoxypiperidin-1-yl]methanone
(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-[(3R)-3-propoxypiperidin-1-yl]methanone (PubChem CID 95588132) has the molecular formula C17H24N4O2
and a molecular weight of 316.41 g/mol. Its IUPAC name is (1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-[(3R)-3-propoxypiperidin-1-yl]methanone.
Molecular Properties
| Compound Name | (1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-[(3R)-3-propoxypiperidin-1-yl]methanone |
| PubChem CID | 95588132 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | (1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-[(3R)-3-propoxypiperidin-1-yl]methanone |
| SMILES | CCCO[C@@H]1CCCN(C(=O)c2cnc3c(c2)c(C)nn3C)C1 |
| InChI | InChI=1S/C17H24N4O2/c1-4-8-23-14-6-5-7-21(11-14)17(22)13-9-15-12(2)19-20(3)16(15)18-10-13/h9-10,14H,4-8,11H2,1-3H3/t14-/m1/s1 |
| InChIKey | JXVGUJJNTJMGNY-CQSZACIVSA-N |
| XLogP | 2.31 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-[(3R)-3-propoxypiperidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-[(3R)-3-propoxypiperidin-1-yl]methanone?
The IUPAC name of (1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-[(3R)-3-propoxypiperidin-1-yl]methanone (CID 95588132) is (1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-[(3R)-3-propoxypiperidin-1-yl]methanone.
What is the SMILES notation for (1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-[(3R)-3-propoxypiperidin-1-yl]methanone?
The canonical SMILES for (1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-[(3R)-3-propoxypiperidin-1-yl]methanone is CCCO[C@@H]1CCCN(C(=O)c2cnc3c(c2)c(C)nn3C)C1.
What is the InChIKey of (1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-[(3R)-3-propoxypiperidin-1-yl]methanone?
The InChIKey is JXVGUJJNTJMGNY-CQSZACIVSA-N. The full InChI is InChI=1S/C17H24N4O2/c1-4-8-23-14-6-5-7-21(11-14)17(22)13-9-15-12(2)19-20(3)16(15)18-10-13/h9-10,14H,4-8,11H2,1-3H3/t14-/m1/s1.
What are the key properties of (1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-[(3R)-3-propoxypiperidin-1-yl]methanone?
(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-[(3R)-3-propoxypiperidin-1-yl]methanone has a molecular weight of 316.41 g/mol, XLogP of 2.31, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-[(3R)-3-propoxypiperidin-1-yl]methanone is sourced from PubChem (CID 95588132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).