About (3S)-N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N-methyl-1,1-dioxothiolan-3-amine
(3S)-N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N-methyl-1,1-dioxothiolan-3-amine (PubChem CID 95592435) has the molecular formula C13H22N2O2S2
and a molecular weight of 302.47 g/mol. Its IUPAC name is (3S)-N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N-methyl-1,1-dioxothiolan-3-amine.
Molecular Properties
| Compound Name | (3S)-N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N-methyl-1,1-dioxothiolan-3-amine |
| PubChem CID | 95592435 |
| Molecular Formula | C13H22N2O2S2 |
| Molecular Weight | 302.47 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | (3S)-N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N-methyl-1,1-dioxothiolan-3-amine |
| SMILES | CN(Cc1csc(C(C)(C)C)n1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H22N2O2S2/c1-13(2,3)12-14-10(8-18-12)7-15(4)11-5-6-19(16,17)9-11/h8,11H,5-7,9H2,1-4H3/t11-/m0/s1 |
| InChIKey | PMSQCUYQFFMXAG-NSHDSACASA-N |
| XLogP | 2.06 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S)-N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N-methyl-1,1-dioxothiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N-methyl-1,1-dioxothiolan-3-amine?
The IUPAC name of (3S)-N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N-methyl-1,1-dioxothiolan-3-amine (CID 95592435) is (3S)-N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N-methyl-1,1-dioxothiolan-3-amine.
What is the SMILES notation for (3S)-N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N-methyl-1,1-dioxothiolan-3-amine?
The canonical SMILES for (3S)-N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N-methyl-1,1-dioxothiolan-3-amine is CN(Cc1csc(C(C)(C)C)n1)[C@H]1CCS(=O)(=O)C1.
What is the InChIKey of (3S)-N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N-methyl-1,1-dioxothiolan-3-amine?
The InChIKey is PMSQCUYQFFMXAG-NSHDSACASA-N. The full InChI is InChI=1S/C13H22N2O2S2/c1-13(2,3)12-14-10(8-18-12)7-15(4)11-5-6-19(16,17)9-11/h8,11H,5-7,9H2,1-4H3/t11-/m0/s1.
What are the key properties of (3S)-N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N-methyl-1,1-dioxothiolan-3-amine?
(3S)-N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N-methyl-1,1-dioxothiolan-3-amine has a molecular weight of 302.47 g/mol, XLogP of 2.06, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N-methyl-1,1-dioxothiolan-3-amine is sourced from PubChem (CID 95592435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).