C19H25N3O2 — CID 95595180
3-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[[(2S)-oxan-2-yl]methyl]benzamide (PubChem CID 95595180) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 3-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[[(2S)-oxan-2-yl]methyl]benzamide.
| Compound Name | 3-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[[(2S)-oxan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 95595180 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 3-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[[(2S)-oxan-2-yl]methyl]benzamide |
| SMILES | Cc1cc(C)n(Cc2cccc(C(=O)NC[C@@H]3CCCCO3)c2)n1 |
| InChI | InChI=1S/C19H25N3O2/c1-14-10-15(2)22(21-14)13-16-6-5-7-17(11-16)19(23)20-12-18-8-3-4-9-24-18/h5-7,10-11,18H,3-4,8-9,12-13H2,1-2H3,(H,20,23)/t18-/m0/s1 |
| InChIKey | ATEAGVUADOBYFT-SFHVURJKSA-N |
| XLogP | 2.85 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |