C15H12ClF2NO2S — CID 95599619
2-[(R)-(4-chlorophenyl)methylsulfinyl]-N-(2,4-difluorophenyl)acetamide (PubChem CID 95599619) has the molecular formula C15H12ClF2NO2S and a molecular weight of 343.78 g/mol. Its IUPAC name is 2-[(R)-(4-chlorophenyl)methylsulfinyl]-N-(2,4-difluorophenyl)acetamide.
| Compound Name | 2-[(R)-(4-chlorophenyl)methylsulfinyl]-N-(2,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 95599619 |
| Molecular Formula | C15H12ClF2NO2S |
| Molecular Weight | 343.78 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 2-[(R)-(4-chlorophenyl)methylsulfinyl]-N-(2,4-difluorophenyl)acetamide |
| SMILES | O=C(C[S@](=O)Cc1ccc(Cl)cc1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C15H12ClF2NO2S/c16-11-3-1-10(2-4-11)8-22(21)9-15(20)19-14-6-5-12(17)7-13(14)18/h1-7H,8-9H2,(H,19,20)/t22-/m1/s1 |
| InChIKey | JTXRLBNEUZVBMB-JOCHJYFZSA-N |
| XLogP | 3.51 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.78 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |