C16H22N4O2 — CID 95603675
(4S)-1-cyclopropyl-4-[(2S)-2-(pyrazol-1-ylmethyl)pyrrolidine-1-carbonyl]pyrrolidin-2-one (PubChem CID 95603675) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is (4S)-1-cyclopropyl-4-[(2S)-2-(pyrazol-1-ylmethyl)pyrrolidine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | (4S)-1-cyclopropyl-4-[(2S)-2-(pyrazol-1-ylmethyl)pyrrolidine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 95603675 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (4S)-1-cyclopropyl-4-[(2S)-2-(pyrazol-1-ylmethyl)pyrrolidine-1-carbonyl]pyrrolidin-2-one |
| SMILES | O=C1C[C@H](C(=O)N2CCC[C@H]2Cn2cccn2)CN1C1CC1 |
| InChI | InChI=1S/C16H22N4O2/c21-15-9-12(10-20(15)13-4-5-13)16(22)19-8-1-3-14(19)11-18-7-2-6-17-18/h2,6-7,12-14H,1,3-5,8-11H2/t12-,14-/m0/s1 |
| InChIKey | AXDQMFKRZSNTHC-JSGCOSHPSA-N |
| XLogP | 0.88 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |