About 1-(2,5-dimethylfuran-3-yl)-N-[4-(4-methylphenoxy)phenyl]methanimine
1-(2,5-dimethylfuran-3-yl)-N-[4-(4-methylphenoxy)phenyl]methanimine (PubChem CID 956039) has the molecular formula C20H19NO2
and a molecular weight of 305.38 g/mol. Its IUPAC name is 1-(2,5-dimethylfuran-3-yl)-N-[4-(4-methylphenoxy)phenyl]methanimine.
Molecular Properties
| Compound Name | 1-(2,5-dimethylfuran-3-yl)-N-[4-(4-methylphenoxy)phenyl]methanimine |
| PubChem CID | 956039 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 1-(2,5-dimethylfuran-3-yl)-N-[4-(4-methylphenoxy)phenyl]methanimine |
| SMILES | Cc1ccc(Oc2ccc(/N=C/c3cc(C)oc3C)cc2)cc1 |
| InChI | InChI=1S/C20H19NO2/c1-14-4-8-19(9-5-14)23-20-10-6-18(7-11-20)21-13-17-12-15(2)22-16(17)3/h4-13H,1-3H3/b21-13+ |
| InChIKey | VPJIUTOLYMUAAF-FYJGNVAPSA-N |
| XLogP | 5.75 |
| TPSA | 34.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,5-dimethylfuran-3-yl)-N-[4-(4-methylphenoxy)phenyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-dimethylfuran-3-yl)-N-[4-(4-methylphenoxy)phenyl]methanimine?
The IUPAC name of 1-(2,5-dimethylfuran-3-yl)-N-[4-(4-methylphenoxy)phenyl]methanimine (CID 956039) is 1-(2,5-dimethylfuran-3-yl)-N-[4-(4-methylphenoxy)phenyl]methanimine.
What is the SMILES notation for 1-(2,5-dimethylfuran-3-yl)-N-[4-(4-methylphenoxy)phenyl]methanimine?
The canonical SMILES for 1-(2,5-dimethylfuran-3-yl)-N-[4-(4-methylphenoxy)phenyl]methanimine is Cc1ccc(Oc2ccc(/N=C/c3cc(C)oc3C)cc2)cc1.
What is the InChIKey of 1-(2,5-dimethylfuran-3-yl)-N-[4-(4-methylphenoxy)phenyl]methanimine?
The InChIKey is VPJIUTOLYMUAAF-FYJGNVAPSA-N. The full InChI is InChI=1S/C20H19NO2/c1-14-4-8-19(9-5-14)23-20-10-6-18(7-11-20)21-13-17-12-15(2)22-16(17)3/h4-13H,1-3H3/b21-13+.
What are the key properties of 1-(2,5-dimethylfuran-3-yl)-N-[4-(4-methylphenoxy)phenyl]methanimine?
1-(2,5-dimethylfuran-3-yl)-N-[4-(4-methylphenoxy)phenyl]methanimine has a molecular weight of 305.38 g/mol, XLogP of 5.75, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-dimethylfuran-3-yl)-N-[4-(4-methylphenoxy)phenyl]methanimine is sourced from PubChem (CID 956039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).