C17H26ClN3O2 — CID 95604391
(2R)-2-(3-chlorophenoxy)-N-[(2S)-2-(4-methylpiperazin-1-yl)propyl]propanamide (PubChem CID 95604391) has the molecular formula C17H26ClN3O2 and a molecular weight of 339.87 g/mol. Its IUPAC name is (2R)-2-(3-chlorophenoxy)-N-[(2S)-2-(4-methylpiperazin-1-yl)propyl]propanamide.
| Compound Name | (2R)-2-(3-chlorophenoxy)-N-[(2S)-2-(4-methylpiperazin-1-yl)propyl]propanamide |
|---|---|
| PubChem CID | 95604391 |
| Molecular Formula | C17H26ClN3O2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (2R)-2-(3-chlorophenoxy)-N-[(2S)-2-(4-methylpiperazin-1-yl)propyl]propanamide |
| SMILES | C[C@@H](Oc1cccc(Cl)c1)C(=O)NC[C@H](C)N1CCN(C)CC1 |
| InChI | InChI=1S/C17H26ClN3O2/c1-13(21-9-7-20(3)8-10-21)12-19-17(22)14(2)23-16-6-4-5-15(18)11-16/h4-6,11,13-14H,7-10,12H2,1-3H3,(H,19,22)/t13-,14+/m0/s1 |
| InChIKey | VCCCWFAIJNWWQT-UONOGXRCSA-N |
| XLogP | 1.86 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |