C18H27ClN2O2 — CID 95605150
(2S)-1-[4-[(5-chloro-2-methoxyphenyl)methyl]piperazin-1-yl]-2-methylpentan-1-one (PubChem CID 95605150) has the molecular formula C18H27ClN2O2 and a molecular weight of 338.88 g/mol. Its IUPAC name is (2S)-1-[4-[(5-chloro-2-methoxyphenyl)methyl]piperazin-1-yl]-2-methylpentan-1-one.
| Compound Name | (2S)-1-[4-[(5-chloro-2-methoxyphenyl)methyl]piperazin-1-yl]-2-methylpentan-1-one |
|---|---|
| PubChem CID | 95605150 |
| Molecular Formula | C18H27ClN2O2 |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | (2S)-1-[4-[(5-chloro-2-methoxyphenyl)methyl]piperazin-1-yl]-2-methylpentan-1-one |
| SMILES | CCC[C@H](C)C(=O)N1CCN(Cc2cc(Cl)ccc2OC)CC1 |
| InChI | InChI=1S/C18H27ClN2O2/c1-4-5-14(2)18(22)21-10-8-20(9-11-21)13-15-12-16(19)6-7-17(15)23-3/h6-7,12,14H,4-5,8-11,13H2,1-3H3/t14-/m0/s1 |
| InChIKey | FHSNDBHXVBFIPV-AWEZNQCLSA-N |
| XLogP | 3.43 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |