C15H23N3O2 — CID 95605673
1-[(2R)-2-[(4-methylpyrazol-1-yl)methyl]pyrrolidin-1-yl]-2-[(2S)-oxolan-2-yl]ethanone (PubChem CID 95605673) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is 1-[(2R)-2-[(4-methylpyrazol-1-yl)methyl]pyrrolidin-1-yl]-2-[(2S)-oxolan-2-yl]ethanone.
| Compound Name | 1-[(2R)-2-[(4-methylpyrazol-1-yl)methyl]pyrrolidin-1-yl]-2-[(2S)-oxolan-2-yl]ethanone |
|---|---|
| PubChem CID | 95605673 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 1-[(2R)-2-[(4-methylpyrazol-1-yl)methyl]pyrrolidin-1-yl]-2-[(2S)-oxolan-2-yl]ethanone |
| SMILES | Cc1cnn(C[C@H]2CCCN2C(=O)C[C@@H]2CCCO2)c1 |
| InChI | InChI=1S/C15H23N3O2/c1-12-9-16-17(10-12)11-13-4-2-6-18(13)15(19)8-14-5-3-7-20-14/h9-10,13-14H,2-8,11H2,1H3/t13-,14+/m1/s1 |
| InChIKey | UVDOVCHBXMLSCR-KGLIPLIRSA-N |
| XLogP | 1.75 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |