About (4-chlorothieno[2,3-b]thiophen-5-yl)-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]methanone
(4-chlorothieno[2,3-b]thiophen-5-yl)-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]methanone (PubChem CID 95606898) has the molecular formula C14H17ClN2O2S2
and a molecular weight of 344.89 g/mol. Its IUPAC name is (4-chlorothieno[2,3-b]thiophen-5-yl)-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]methanone.
Molecular Properties
| Compound Name | (4-chlorothieno[2,3-b]thiophen-5-yl)-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]methanone |
| PubChem CID | 95606898 |
| Molecular Formula | C14H17ClN2O2S2 |
| Molecular Weight | 344.89 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | (4-chlorothieno[2,3-b]thiophen-5-yl)-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]methanone |
| SMILES | C[C@@H](O)CN1CCN(C(=O)c2sc3sccc3c2Cl)CC1 |
| InChI | InChI=1S/C14H17ClN2O2S2/c1-9(18)8-16-3-5-17(6-4-16)13(19)12-11(15)10-2-7-20-14(10)21-12/h2,7,9,18H,3-6,8H2,1H3/t9-/m1/s1 |
| InChIKey | LLGGDBXHSKZWOT-SECBINFHSA-N |
| XLogP | 2.75 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.89 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-chlorothieno[2,3-b]thiophen-5-yl)-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorothieno[2,3-b]thiophen-5-yl)-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]methanone?
The IUPAC name of (4-chlorothieno[2,3-b]thiophen-5-yl)-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]methanone (CID 95606898) is (4-chlorothieno[2,3-b]thiophen-5-yl)-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]methanone.
What is the SMILES notation for (4-chlorothieno[2,3-b]thiophen-5-yl)-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]methanone?
The canonical SMILES for (4-chlorothieno[2,3-b]thiophen-5-yl)-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]methanone is C[C@@H](O)CN1CCN(C(=O)c2sc3sccc3c2Cl)CC1.
What is the InChIKey of (4-chlorothieno[2,3-b]thiophen-5-yl)-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]methanone?
The InChIKey is LLGGDBXHSKZWOT-SECBINFHSA-N. The full InChI is InChI=1S/C14H17ClN2O2S2/c1-9(18)8-16-3-5-17(6-4-16)13(19)12-11(15)10-2-7-20-14(10)21-12/h2,7,9,18H,3-6,8H2,1H3/t9-/m1/s1.
What are the key properties of (4-chlorothieno[2,3-b]thiophen-5-yl)-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]methanone?
(4-chlorothieno[2,3-b]thiophen-5-yl)-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]methanone has a molecular weight of 344.89 g/mol, XLogP of 2.75, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorothieno[2,3-b]thiophen-5-yl)-[4-[(2R)-2-hydroxypropyl]piperazin-1-yl]methanone is sourced from PubChem (CID 95606898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).