C16H15F3N6 — CID 95609013
N-[(6S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-2-(trifluoromethyl)quinazolin-4-amine (PubChem CID 95609013) has the molecular formula C16H15F3N6 and a molecular weight of 348.33 g/mol. Its IUPAC name is N-[(6S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-2-(trifluoromethyl)quinazolin-4-amine.
| Compound Name | N-[(6S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-2-(trifluoromethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 95609013 |
| Molecular Formula | C16H15F3N6 |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | N-[(6S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-2-(trifluoromethyl)quinazolin-4-amine |
| SMILES | Cc1nc2n(n1)C[C@@H](Nc1nc(C(F)(F)F)nc3ccccc13)CC2 |
| InChI | InChI=1S/C16H15F3N6/c1-9-20-13-7-6-10(8-25(13)24-9)21-14-11-4-2-3-5-12(11)22-15(23-14)16(17,18)19/h2-5,10H,6-8H2,1H3,(H,21,22,23)/t10-/m0/s1 |
| InChIKey | MQWIKKISBDQVEL-JTQLQIEISA-N |
| XLogP | 2.98 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |