C17H28N6S — CID 95610713
N,N-diethyl-5-[[[(6R)-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]methyl]-1,3-thiazol-2-amine (PubChem CID 95610713) has the molecular formula C17H28N6S and a molecular weight of 348.52 g/mol. Its IUPAC name is N,N-diethyl-5-[[[(6R)-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]methyl]-1,3-thiazol-2-amine.
| Compound Name | N,N-diethyl-5-[[[(6R)-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 95610713 |
| Molecular Formula | C17H28N6S |
| Molecular Weight | 348.52 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | N,N-diethyl-5-[[[(6R)-2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]methyl]-1,3-thiazol-2-amine |
| SMILES | CCN(CC)c1ncc(CN[C@@H]2CCc3nc(C(C)C)nn3C2)s1 |
| InChI | InChI=1S/C17H28N6S/c1-5-22(6-2)17-19-10-14(24-17)9-18-13-7-8-15-20-16(12(3)4)21-23(15)11-13/h10,12-13,18H,5-9,11H2,1-4H3/t13-/m1/s1 |
| InChIKey | QFSFTDGHORMFDG-CYBMUJFWSA-N |
| XLogP | 2.81 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.52 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |