C16H26N6 — CID 95610747
N-[(1-tert-butylpyrazol-4-yl)methyl]-1-[(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanamine (PubChem CID 95610747) has the molecular formula C16H26N6 and a molecular weight of 302.43 g/mol. Its IUPAC name is N-[(1-tert-butylpyrazol-4-yl)methyl]-1-[(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanamine.
| Compound Name | N-[(1-tert-butylpyrazol-4-yl)methyl]-1-[(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanamine |
|---|---|
| PubChem CID | 95610747 |
| Molecular Formula | C16H26N6 |
| Molecular Weight | 302.43 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | N-[(1-tert-butylpyrazol-4-yl)methyl]-1-[(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanamine |
| SMILES | Cc1nnc2n1C[C@H](CNCc1cnn(C(C)(C)C)c1)CC2 |
| InChI | InChI=1S/C16H26N6/c1-12-19-20-15-6-5-13(10-21(12)15)7-17-8-14-9-18-22(11-14)16(2,3)4/h9,11,13,17H,5-8,10H2,1-4H3/t13-/m0/s1 |
| InChIKey | MWFRPTVGLUXOQL-ZDUSSCGKSA-N |
| XLogP | 1.89 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.43 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |