C19H23N5 — CID 95611660
2-methyl-3-[[(2S)-2-[(4-methylpyrazol-1-yl)methyl]pyrrolidin-1-yl]methyl]quinoxaline (PubChem CID 95611660) has the molecular formula C19H23N5 and a molecular weight of 321.43 g/mol. Its IUPAC name is 2-methyl-3-[[(2S)-2-[(4-methylpyrazol-1-yl)methyl]pyrrolidin-1-yl]methyl]quinoxaline.
| Compound Name | 2-methyl-3-[[(2S)-2-[(4-methylpyrazol-1-yl)methyl]pyrrolidin-1-yl]methyl]quinoxaline |
|---|---|
| PubChem CID | 95611660 |
| Molecular Formula | C19H23N5 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | 2-methyl-3-[[(2S)-2-[(4-methylpyrazol-1-yl)methyl]pyrrolidin-1-yl]methyl]quinoxaline |
| SMILES | Cc1cnn(C[C@@H]2CCCN2Cc2nc3ccccc3nc2C)c1 |
| InChI | InChI=1S/C19H23N5/c1-14-10-20-24(11-14)12-16-6-5-9-23(16)13-19-15(2)21-17-7-3-4-8-18(17)22-19/h3-4,7-8,10-11,16H,5-6,9,12-13H2,1-2H3/t16-/m0/s1 |
| InChIKey | HTRHSCZLBWKZRY-INIZCTEOSA-N |
| XLogP | 3.11 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |