C17H30N4O2 — CID 95611845
N-(1-cyanocycloheptyl)-2-[(2R)-2-[(dimethylamino)methyl]morpholin-4-yl]acetamide (PubChem CID 95611845) has the molecular formula C17H30N4O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is N-(1-cyanocycloheptyl)-2-[(2R)-2-[(dimethylamino)methyl]morpholin-4-yl]acetamide.
| Compound Name | N-(1-cyanocycloheptyl)-2-[(2R)-2-[(dimethylamino)methyl]morpholin-4-yl]acetamide |
|---|---|
| PubChem CID | 95611845 |
| Molecular Formula | C17H30N4O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | N-(1-cyanocycloheptyl)-2-[(2R)-2-[(dimethylamino)methyl]morpholin-4-yl]acetamide |
| SMILES | CN(C)C[C@@H]1CN(CC(=O)NC2(C#N)CCCCCC2)CCO1 |
| InChI | InChI=1S/C17H30N4O2/c1-20(2)11-15-12-21(9-10-23-15)13-16(22)19-17(14-18)7-5-3-4-6-8-17/h15H,3-13H2,1-2H3,(H,19,22)/t15-/m1/s1 |
| InChIKey | AYWSIBHNLVLHNS-OAHLLOKOSA-N |
| XLogP | 0.98 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |