C16H27N3O3 — CID 95612816
2-[(2R)-2-[(2S)-1-acetylpyrrolidin-2-yl]pyrrolidin-1-yl]-1-morpholin-4-ylethanone (PubChem CID 95612816) has the molecular formula C16H27N3O3 and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-[(2R)-2-[(2S)-1-acetylpyrrolidin-2-yl]pyrrolidin-1-yl]-1-morpholin-4-ylethanone.
| Compound Name | 2-[(2R)-2-[(2S)-1-acetylpyrrolidin-2-yl]pyrrolidin-1-yl]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 95612816 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 2-[(2R)-2-[(2S)-1-acetylpyrrolidin-2-yl]pyrrolidin-1-yl]-1-morpholin-4-ylethanone |
| SMILES | CC(=O)N1CCC[C@H]1[C@H]1CCCN1CC(=O)N1CCOCC1 |
| InChI | InChI=1S/C16H27N3O3/c1-13(20)19-7-3-5-15(19)14-4-2-6-18(14)12-16(21)17-8-10-22-11-9-17/h14-15H,2-12H2,1H3/t14-,15+/m1/s1 |
| InChIKey | NKYWBHUHENTBKI-CABCVRRESA-N |
| XLogP | 0.32 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |