About 1-[(1R)-1-(4-methyl-1,3-thiazol-2-yl)ethyl]-3-[(3S)-1-phenylpyrrolidin-3-yl]urea
1-[(1R)-1-(4-methyl-1,3-thiazol-2-yl)ethyl]-3-[(3S)-1-phenylpyrrolidin-3-yl]urea (PubChem CID 95614224) has the molecular formula C17H22N4OS
and a molecular weight of 330.46 g/mol. Its IUPAC name is 1-[(1R)-1-(4-methyl-1,3-thiazol-2-yl)ethyl]-3-[(3S)-1-phenylpyrrolidin-3-yl]urea.
Molecular Properties
| Compound Name | 1-[(1R)-1-(4-methyl-1,3-thiazol-2-yl)ethyl]-3-[(3S)-1-phenylpyrrolidin-3-yl]urea |
| PubChem CID | 95614224 |
| Molecular Formula | C17H22N4OS |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 1-[(1R)-1-(4-methyl-1,3-thiazol-2-yl)ethyl]-3-[(3S)-1-phenylpyrrolidin-3-yl]urea |
| SMILES | Cc1csc([C@@H](C)NC(=O)N[C@H]2CCN(c3ccccc3)C2)n1 |
| InChI | InChI=1S/C17H22N4OS/c1-12-11-23-16(18-12)13(2)19-17(22)20-14-8-9-21(10-14)15-6-4-3-5-7-15/h3-7,11,13-14H,8-10H2,1-2H3,(H2,19,20,22)/t13-,14+/m1/s1 |
| InChIKey | VSDGQKZHURGSEN-KGLIPLIRSA-N |
| XLogP | 3.09 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(1R)-1-(4-methyl-1,3-thiazol-2-yl)ethyl]-3-[(3S)-1-phenylpyrrolidin-3-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R)-1-(4-methyl-1,3-thiazol-2-yl)ethyl]-3-[(3S)-1-phenylpyrrolidin-3-yl]urea?
The IUPAC name of 1-[(1R)-1-(4-methyl-1,3-thiazol-2-yl)ethyl]-3-[(3S)-1-phenylpyrrolidin-3-yl]urea (CID 95614224) is 1-[(1R)-1-(4-methyl-1,3-thiazol-2-yl)ethyl]-3-[(3S)-1-phenylpyrrolidin-3-yl]urea.
What is the SMILES notation for 1-[(1R)-1-(4-methyl-1,3-thiazol-2-yl)ethyl]-3-[(3S)-1-phenylpyrrolidin-3-yl]urea?
The canonical SMILES for 1-[(1R)-1-(4-methyl-1,3-thiazol-2-yl)ethyl]-3-[(3S)-1-phenylpyrrolidin-3-yl]urea is Cc1csc([C@@H](C)NC(=O)N[C@H]2CCN(c3ccccc3)C2)n1.
What is the InChIKey of 1-[(1R)-1-(4-methyl-1,3-thiazol-2-yl)ethyl]-3-[(3S)-1-phenylpyrrolidin-3-yl]urea?
The InChIKey is VSDGQKZHURGSEN-KGLIPLIRSA-N. The full InChI is InChI=1S/C17H22N4OS/c1-12-11-23-16(18-12)13(2)19-17(22)20-14-8-9-21(10-14)15-6-4-3-5-7-15/h3-7,11,13-14H,8-10H2,1-2H3,(H2,19,20,22)/t13-,14+/m1/s1.
What are the key properties of 1-[(1R)-1-(4-methyl-1,3-thiazol-2-yl)ethyl]-3-[(3S)-1-phenylpyrrolidin-3-yl]urea?
1-[(1R)-1-(4-methyl-1,3-thiazol-2-yl)ethyl]-3-[(3S)-1-phenylpyrrolidin-3-yl]urea has a molecular weight of 330.46 g/mol, XLogP of 3.09, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R)-1-(4-methyl-1,3-thiazol-2-yl)ethyl]-3-[(3S)-1-phenylpyrrolidin-3-yl]urea is sourced from PubChem (CID 95614224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).