C17H26N4O — CID 95614231
1-methyl-3-(1-prop-2-enylpiperidin-4-yl)-1-[(1R)-1-pyridin-3-ylethyl]urea (PubChem CID 95614231) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is 1-methyl-3-(1-prop-2-enylpiperidin-4-yl)-1-[(1R)-1-pyridin-3-ylethyl]urea.
| Compound Name | 1-methyl-3-(1-prop-2-enylpiperidin-4-yl)-1-[(1R)-1-pyridin-3-ylethyl]urea |
|---|---|
| PubChem CID | 95614231 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 1-methyl-3-(1-prop-2-enylpiperidin-4-yl)-1-[(1R)-1-pyridin-3-ylethyl]urea |
| SMILES | C=CCN1CCC(NC(=O)N(C)[C@H](C)c2cccnc2)CC1 |
| InChI | InChI=1S/C17H26N4O/c1-4-10-21-11-7-16(8-12-21)19-17(22)20(3)14(2)15-6-5-9-18-13-15/h4-6,9,13-14,16H,1,7-8,10-12H2,2-3H3,(H,19,22)/t14-/m1/s1 |
| InChIKey | HXADZJUFZHKTBB-CQSZACIVSA-N |
| XLogP | 2.43 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|